C17H19NO3S9Si — CID 21479771
[2-(1,3-benzothiazol-2-yloctasulfanyl)-5-methylphenyl]-trimethoxysilane (PubChem CID 21479771) has the molecular formula C17H19NO3S9Si and a molecular weight of 602.03 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yloctasulfanyl)-5-methylphenyl]-trimethoxysilane.
| Compound Name | [2-(1,3-benzothiazol-2-yloctasulfanyl)-5-methylphenyl]-trimethoxysilane |
|---|---|
| PubChem CID | 21479771 |
| Molecular Formula | C17H19NO3S9Si |
| Molecular Weight | 602.03 g/mol |
| Exact Mass | 600.86 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yloctasulfanyl)-5-methylphenyl]-trimethoxysilane |
| SMILES | CO[Si](OC)(OC)c1cc(C)ccc1SSSSSSSSc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H19NO3S9Si/c1-12-9-10-15(16(11-12)31(19-2,20-3)21-4)23-25-27-29-30-28-26-24-17-18-13-7-5-6-8-14(13)22-17/h5-11H,1-4H3 |
| InChIKey | OKLPBEXFGFSIEG-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.03 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|