C23H31NO3S8Si — CID 21479869
3-[2-(1,3-benzothiazol-2-ylheptasulfanyl)-5-methylphenyl]propyl-triethoxysilane (PubChem CID 21479869) has the molecular formula C23H31NO3S8Si and a molecular weight of 654.13 g/mol. Its IUPAC name is 3-[2-(1,3-benzothiazol-2-ylheptasulfanyl)-5-methylphenyl]propyl-triethoxysilane.
| Compound Name | 3-[2-(1,3-benzothiazol-2-ylheptasulfanyl)-5-methylphenyl]propyl-triethoxysilane |
|---|---|
| PubChem CID | 21479869 |
| Molecular Formula | C23H31NO3S8Si |
| Molecular Weight | 654.13 g/mol |
| Exact Mass | 652.98 |
| IUPAC Name | 3-[2-(1,3-benzothiazol-2-ylheptasulfanyl)-5-methylphenyl]propyl-triethoxysilane |
| SMILES | CCO[Si](CCCc1cc(C)ccc1SSSSSSSc1nc2ccccc2s1)(OCC)OCC |
| InChI | InChI=1S/C23H31NO3S8Si/c1-5-25-36(26-6-2,27-7-3)16-10-11-19-17-18(4)14-15-21(19)29-31-33-35-34-32-30-23-24-20-12-8-9-13-22(20)28-23/h8-9,12-15,17H,5-7,10-11,16H2,1-4H3 |
| InChIKey | NXLXVCDULWLXIA-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.13 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|