C22H29NO3S3Si — CID 21479876
[3-(1,3-benzothiazol-2-yldisulfanyl)-2-propylphenyl]-triethoxysilane (PubChem CID 21479876) has the molecular formula C22H29NO3S3Si and a molecular weight of 479.77 g/mol. Its IUPAC name is [3-(1,3-benzothiazol-2-yldisulfanyl)-2-propylphenyl]-triethoxysilane.
| Compound Name | [3-(1,3-benzothiazol-2-yldisulfanyl)-2-propylphenyl]-triethoxysilane |
|---|---|
| PubChem CID | 21479876 |
| Molecular Formula | C22H29NO3S3Si |
| Molecular Weight | 479.77 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | [3-(1,3-benzothiazol-2-yldisulfanyl)-2-propylphenyl]-triethoxysilane |
| SMILES | CCCc1c(SSc2nc3ccccc3s2)cccc1[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C22H29NO3S3Si/c1-5-12-17-19(28-29-22-23-18-13-9-10-14-20(18)27-22)15-11-16-21(17)30(24-6-2,25-7-3)26-8-4/h9-11,13-16H,5-8,12H2,1-4H3 |
| InChIKey | VZRVYUBFARDPSP-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.77 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|