C18H29NO3S7Si — CID 54206836
2-(1,3-benzothiazol-2-ylhexasulfanyl)ethyl-tripropoxysilane (PubChem CID 54206836) has the molecular formula C18H29NO3S7Si and a molecular weight of 559.99 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylhexasulfanyl)ethyl-tripropoxysilane.
| Compound Name | 2-(1,3-benzothiazol-2-ylhexasulfanyl)ethyl-tripropoxysilane |
|---|---|
| PubChem CID | 54206836 |
| Molecular Formula | C18H29NO3S7Si |
| Molecular Weight | 559.99 g/mol |
| Exact Mass | 559.00 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylhexasulfanyl)ethyl-tripropoxysilane |
| SMILES | CCCO[Si](CCSSSSSSc1nc2ccccc2s1)(OCCC)OCCC |
| InChI | InChI=1S/C18H29NO3S7Si/c1-4-11-20-30(21-12-5-2,22-13-6-3)15-14-23-26-28-29-27-25-18-19-16-9-7-8-10-17(16)24-18/h7-10H,4-6,11-15H2,1-3H3 |
| InChIKey | PTBTZZOMSGKWAE-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.99 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|