C20H25NO3S4Si — CID 21479973
3-[2-(1,3-benzothiazol-2-yltrisulfanyl)-5-methylphenyl]propyl-trimethoxysilane (PubChem CID 21479973) has the molecular formula C20H25NO3S4Si and a molecular weight of 483.78 g/mol. Its IUPAC name is 3-[2-(1,3-benzothiazol-2-yltrisulfanyl)-5-methylphenyl]propyl-trimethoxysilane.
| Compound Name | 3-[2-(1,3-benzothiazol-2-yltrisulfanyl)-5-methylphenyl]propyl-trimethoxysilane |
|---|---|
| PubChem CID | 21479973 |
| Molecular Formula | C20H25NO3S4Si |
| Molecular Weight | 483.78 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | 3-[2-(1,3-benzothiazol-2-yltrisulfanyl)-5-methylphenyl]propyl-trimethoxysilane |
| SMILES | CO[Si](CCCc1cc(C)ccc1SSSc1nc2ccccc2s1)(OC)OC |
| InChI | InChI=1S/C20H25NO3S4Si/c1-15-11-12-18(16(14-15)8-7-13-29(22-2,23-3)24-4)26-28-27-20-21-17-9-5-6-10-19(17)25-20/h5-6,9-12,14H,7-8,13H2,1-4H3 |
| InChIKey | DJSSCRMIORZMAH-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.78 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|