C13H13Cl3N2OS2 — CID 7032065
N-[(1R)-1-(1,3-benzothiazol-2-ylsulfanyl)-2,2,2-trichloroethyl]butanamide (PubChem CID 7032065) has the molecular formula C13H13Cl3N2OS2 and a molecular weight of 383.75 g/mol. Its IUPAC name is N-[(1R)-1-(1,3-benzothiazol-2-ylsulfanyl)-2,2,2-trichloroethyl]butanamide.
| Compound Name | N-[(1R)-1-(1,3-benzothiazol-2-ylsulfanyl)-2,2,2-trichloroethyl]butanamide |
|---|---|
| PubChem CID | 7032065 |
| Molecular Formula | C13H13Cl3N2OS2 |
| Molecular Weight | 383.75 g/mol |
| Exact Mass | 381.95 |
| IUPAC Name | N-[(1R)-1-(1,3-benzothiazol-2-ylsulfanyl)-2,2,2-trichloroethyl]butanamide |
| SMILES | CCCC(=O)N[C@H](Sc1nc2ccccc2s1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H13Cl3N2OS2/c1-2-5-10(19)18-11(13(14,15)16)21-12-17-8-6-3-4-7-9(8)20-12/h3-4,6-7,11H,2,5H2,1H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | FYPGVBJIBQXFMB-LLVKDONJSA-N |
| XLogP | 5.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.75 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|