C22H25N3O2S2 — CID 70411381
2-[1,3-benzothiazol-2-ylsulfanyl(phenyl)methyl]-N,N'-diethylbutanediamide (PubChem CID 70411381) has the molecular formula C22H25N3O2S2 and a molecular weight of 427.60 g/mol. Its IUPAC name is 2-[1,3-benzothiazol-2-ylsulfanyl(phenyl)methyl]-N,N'-diethylbutanediamide.
| Compound Name | 2-[1,3-benzothiazol-2-ylsulfanyl(phenyl)methyl]-N,N'-diethylbutanediamide |
|---|---|
| PubChem CID | 70411381 |
| Molecular Formula | C22H25N3O2S2 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2-[1,3-benzothiazol-2-ylsulfanyl(phenyl)methyl]-N,N'-diethylbutanediamide |
| SMILES | CCNC(=O)CC(C(=O)NCC)C(Sc1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C22H25N3O2S2/c1-3-23-19(26)14-16(21(27)24-4-2)20(15-10-6-5-7-11-15)29-22-25-17-12-8-9-13-18(17)28-22/h5-13,16,20H,3-4,14H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | VOERTJAFLOMIFC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |