C21H14I2N4O3S — CID 21370366
N-[(E)-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 21370366) has the molecular formula C21H14I2N4O3S and a molecular weight of 656.24 g/mol. Its IUPAC name is N-[(E)-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(E)-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 21370366 |
| Molecular Formula | C21H14I2N4O3S |
| Molecular Weight | 656.24 g/mol |
| Exact Mass | 655.89 |
| IUPAC Name | N-[(E)-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc(COc2c(I)cc(/C=N/Nc3nc4ccccc4s3)cc2I)cc1 |
| InChI | InChI=1S/C21H14I2N4O3S/c22-16-9-14(11-24-26-21-25-18-3-1-2-4-19(18)31-21)10-17(23)20(16)30-12-13-5-7-15(8-6-13)27(28)29/h1-11H,12H2,(H,25,26)/b24-11+ |
| InChIKey | IZXZBDCLTZWXRF-BHGWPJFGSA-N |
| XLogP | 6.44 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.24 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|