C25H20N2O3S — CID 50885648
butyl 3-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoate (PubChem CID 50885648) has the molecular formula C25H20N2O3S and a molecular weight of 428.51 g/mol. Its IUPAC name is butyl 3-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoate.
| Compound Name | butyl 3-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 50885648 |
| Molecular Formula | C25H20N2O3S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | butyl 3-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1cccc(-c2ccc(/C=C(/C#N)c3nc4ccccc4s3)o2)c1 |
| InChI | InChI=1S/C25H20N2O3S/c1-2-3-13-29-25(28)18-8-6-7-17(14-18)22-12-11-20(30-22)15-19(16-26)24-27-21-9-4-5-10-23(21)31-24/h4-12,14-15H,2-3,13H2,1H3/b19-15- |
| InChIKey | PNHLARHNKRTQJY-CYVLTUHYSA-N |
| XLogP | 6.58 |
| TPSA | 76.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|