C22H22N2O2S — CID 3542321
2-(1,3-benzothiazol-2-yl)-3-(2,4-dipropoxyphenyl)prop-2-enenitrile (PubChem CID 3542321) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-(2,4-dipropoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-(2,4-dipropoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3542321 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-(2,4-dipropoxyphenyl)prop-2-enenitrile |
| SMILES | CCCOc1ccc(C=C(C#N)c2nc3ccccc3s2)c(OCCC)c1 |
| InChI | InChI=1S/C22H22N2O2S/c1-3-11-25-18-10-9-16(20(14-18)26-12-4-2)13-17(15-23)22-24-19-7-5-6-8-21(19)27-22/h5-10,13-14H,3-4,11-12H2,1-2H3 |
| InChIKey | LXIRIODYADTCMS-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|