C20H12N2S2 — CID 16649395
(E)-2-(1,3-benzothiazol-2-yl)-3-(4-phenylthiophen-2-yl)prop-2-enenitrile (PubChem CID 16649395) has the molecular formula C20H12N2S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-yl)-3-(4-phenylthiophen-2-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-yl)-3-(4-phenylthiophen-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 16649395 |
| Molecular Formula | C20H12N2S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-yl)-3-(4-phenylthiophen-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(-c2ccccc2)cs1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H12N2S2/c21-12-15(20-22-18-8-4-5-9-19(18)24-20)10-17-11-16(13-23-17)14-6-2-1-3-7-14/h1-11,13H/b15-10+ |
| InChIKey | RMZHQDFRBOOORF-XNTDXEJSSA-N |
| XLogP | 6.09 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|