C25H15ClN4S — CID 18807097
(Z)-2-(1,3-benzothiazol-2-yl)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]prop-2-enenitrile (PubChem CID 18807097) has the molecular formula C25H15ClN4S and a molecular weight of 438.94 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]prop-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 18807097 |
| Molecular Formula | C25H15ClN4S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C25H15ClN4S/c26-20-12-10-17(11-13-20)24-19(16-30(29-24)21-6-2-1-3-7-21)14-18(15-27)25-28-22-8-4-5-9-23(22)31-25/h1-14,16H/b18-14- |
| InChIKey | JMZUNUMVRBOIPN-JXAWBTAJSA-N |
| XLogP | 6.87 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|