C27H21N5O2S2 — CID 3858353
4-[4-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-1-phenylpyrazol-3-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 3858353) has the molecular formula C27H21N5O2S2 and a molecular weight of 511.63 g/mol. Its IUPAC name is 4-[4-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-1-phenylpyrazol-3-yl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[4-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-1-phenylpyrazol-3-yl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3858353 |
| Molecular Formula | C27H21N5O2S2 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 4-[4-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-1-phenylpyrazol-3-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(-c2nn(-c3ccccc3)cc2C=C(C#N)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C27H21N5O2S2/c1-31(2)36(33,34)23-14-12-19(13-15-23)26-21(18-32(30-26)22-8-4-3-5-9-22)16-20(17-28)27-29-24-10-6-7-11-25(24)35-27/h3-16,18H,1-2H3 |
| InChIKey | OQSYOQRGVANCEV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 91.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|