C32H21ClN4OS — CID 4699865
2-(1,3-benzothiazol-2-yl)-3-[3-[3-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]prop-2-enenitrile (PubChem CID 4699865) has the molecular formula C32H21ClN4OS and a molecular weight of 545.07 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-[3-[3-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-[3-[3-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4699865 |
| Molecular Formula | C32H21ClN4OS |
| Molecular Weight | 545.07 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-[3-[3-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1cn(-c2ccccc2)nc1-c1cccc(OCc2ccccc2Cl)c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C32H21ClN4OS/c33-28-14-5-4-9-23(28)21-38-27-13-8-10-22(18-27)31-25(20-37(36-31)26-11-2-1-3-12-26)17-24(19-34)32-35-29-15-6-7-16-30(29)39-32/h1-18,20H,21H2 |
| InChIKey | OEYOMZWYKYRIRO-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.07 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|