C28H22N4OS — CID 6309249
(E)-2-(1,3-benzothiazol-2-yl)-3-[3-(4-ethoxy-3-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enenitrile (PubChem CID 6309249) has the molecular formula C28H22N4OS and a molecular weight of 462.58 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-yl)-3-[3-(4-ethoxy-3-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-yl)-3-[3-(4-ethoxy-3-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6309249 |
| Molecular Formula | C28H22N4OS |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-yl)-3-[3-(4-ethoxy-3-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enenitrile |
| SMILES | CCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C(\C#N)c2nc3ccccc3s2)cc1C |
| InChI | InChI=1S/C28H22N4OS/c1-3-33-25-14-13-20(15-19(25)2)27-22(18-32(31-27)23-9-5-4-6-10-23)16-21(17-29)28-30-24-11-7-8-12-26(24)34-28/h4-16,18H,3H2,1-2H3/b21-16+ |
| InChIKey | FOXQOWZSJTWUAF-LTGZKZEYSA-N |
| XLogP | 6.92 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|