C20H13ClN4S — CID 2789981
2-(1,3-benzothiazol-2-yl)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)prop-2-enenitrile (PubChem CID 2789981) has the molecular formula C20H13ClN4S and a molecular weight of 376.87 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2789981 |
| Molecular Formula | C20H13ClN4S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)prop-2-enenitrile |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C=C(C#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H13ClN4S/c1-13-16(19(21)25(24-13)15-7-3-2-4-8-15)11-14(12-22)20-23-17-9-5-6-10-18(17)26-20/h2-11H,1H3 |
| InChIKey | LCUHZCYFVGPRFI-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|