C18H22N2S — CID 154614988
(E)-2-(6-tert-butyl-1,3-benzothiazol-2-yl)-4,4-dimethylpent-2-enenitrile (PubChem CID 154614988) has the molecular formula C18H22N2S and a molecular weight of 298.46 g/mol. Its IUPAC name is (E)-2-(6-tert-butyl-1,3-benzothiazol-2-yl)-4,4-dimethylpent-2-enenitrile.
| Compound Name | (E)-2-(6-tert-butyl-1,3-benzothiazol-2-yl)-4,4-dimethylpent-2-enenitrile |
|---|---|
| PubChem CID | 154614988 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (E)-2-(6-tert-butyl-1,3-benzothiazol-2-yl)-4,4-dimethylpent-2-enenitrile |
| SMILES | CC(C)(C)/C=C(\C#N)c1nc2ccc(C(C)(C)C)cc2s1 |
| InChI | InChI=1S/C18H22N2S/c1-17(2,3)10-12(11-19)16-20-14-8-7-13(18(4,5)6)9-15(14)21-16/h7-10H,1-6H3/b12-10+ |
| InChIKey | GLHLFLUHPZCMKE-ZRDIBKRKSA-N |
| XLogP | 5.55 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|