C16H8ClN3O2S — CID 4702522
3-(6-chloro-3-pyridinyl)-3-hydroxy-2-(4-oxo-1,3-benzothiazin-2-yl)prop-2-enenitrile (PubChem CID 4702522) has the molecular formula C16H8ClN3O2S and a molecular weight of 341.78 g/mol. Its IUPAC name is 3-(6-chloro-3-pyridinyl)-3-hydroxy-2-(4-oxo-1,3-benzothiazin-2-yl)prop-2-enenitrile.
| Compound Name | 3-(6-chloro-3-pyridinyl)-3-hydroxy-2-(4-oxo-1,3-benzothiazin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4702522 |
| Molecular Formula | C16H8ClN3O2S |
| Molecular Weight | 341.78 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 3-(6-chloro-3-pyridinyl)-3-hydroxy-2-(4-oxo-1,3-benzothiazin-2-yl)prop-2-enenitrile |
| SMILES | N#CC(=C(O)c1ccc(Cl)nc1)c1nc(=O)c2ccccc2s1 |
| InChI | InChI=1S/C16H8ClN3O2S/c17-13-6-5-9(8-19-13)14(21)11(7-18)16-20-15(22)10-3-1-2-4-12(10)23-16/h1-6,8,21H |
| InChIKey | DWWCYVPYAYFZRL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.78 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|