C21H12F6O2 — CID 170221584
(6-ethenylnaphthalen-2-yl) 3,5-bis(trifluoromethyl)benzoate (PubChem CID 170221584) has the molecular formula C21H12F6O2 and a molecular weight of 410.31 g/mol. Its IUPAC name is (6-ethenylnaphthalen-2-yl) 3,5-bis(trifluoromethyl)benzoate.
| Compound Name | (6-ethenylnaphthalen-2-yl) 3,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 170221584 |
| Molecular Formula | C21H12F6O2 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | (6-ethenylnaphthalen-2-yl) 3,5-bis(trifluoromethyl)benzoate |
| SMILES | C=Cc1ccc2cc(OC(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc2c1 |
| InChI | InChI=1S/C21H12F6O2/c1-2-12-3-4-14-10-18(6-5-13(14)7-12)29-19(28)15-8-16(20(22,23)24)11-17(9-15)21(25,26)27/h2-11H,1H2 |
| InChIKey | ODUCVFUXEMHORQ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|