C15H12F2O6S — CID 154615112
2-[(6-ethenylnaphthalen-2-yl)oxymethoxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 154615112) has the molecular formula C15H12F2O6S and a molecular weight of 358.32 g/mol. Its IUPAC name is 2-[(6-ethenylnaphthalen-2-yl)oxymethoxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[(6-ethenylnaphthalen-2-yl)oxymethoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 154615112 |
| Molecular Formula | C15H12F2O6S |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 2-[(6-ethenylnaphthalen-2-yl)oxymethoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | C=Cc1ccc2cc(OCOC(=O)C(F)(F)S(=O)(=O)O)ccc2c1 |
| InChI | InChI=1S/C15H12F2O6S/c1-2-10-3-4-12-8-13(6-5-11(12)7-10)22-9-23-14(18)15(16,17)24(19,20)21/h2-8H,1,9H2,(H,19,20,21) |
| InChIKey | YCOLRRKZQYKZOE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|