C18H18F2O5S — CID 89031249
1,1-difluoro-2-[[4-[(1Z,5Z)-4-methylideneocta-1,5,7-trienyl]phenyl]methoxy]-2-oxoethanesulfonic acid (PubChem CID 89031249) has the molecular formula C18H18F2O5S and a molecular weight of 384.40 g/mol. Its IUPAC name is 1,1-difluoro-2-[[4-[(1Z,5Z)-4-methylideneocta-1,5,7-trienyl]phenyl]methoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[4-[(1Z,5Z)-4-methylideneocta-1,5,7-trienyl]phenyl]methoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 89031249 |
| Molecular Formula | C18H18F2O5S |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 1,1-difluoro-2-[[4-[(1Z,5Z)-4-methylideneocta-1,5,7-trienyl]phenyl]methoxy]-2-oxoethanesulfonic acid |
| SMILES | C=C/C=C\C(=C)C/C=C\c1ccc(COC(=O)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C18H18F2O5S/c1-3-4-6-14(2)7-5-8-15-9-11-16(12-10-15)13-25-17(21)18(19,20)26(22,23)24/h3-6,8-12H,1-2,7,13H2,(H,22,23,24)/b6-4-,8-5- |
| InChIKey | ISVVUAPTWMKHJB-VXWIUBPCSA-N |
| XLogP | 3.91 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|