C16H12F2O5S — CID 89185303
1,1-difluoro-2-oxo-2-(6H-phenalen-2-ylmethoxy)ethanesulfonic acid (PubChem CID 89185303) has the molecular formula C16H12F2O5S and a molecular weight of 354.33 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-(6H-phenalen-2-ylmethoxy)ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-(6H-phenalen-2-ylmethoxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 89185303 |
| Molecular Formula | C16H12F2O5S |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-(6H-phenalen-2-ylmethoxy)ethanesulfonic acid |
| SMILES | O=C(OCc1cc2c3c(cccc3c1)CC=C2)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C16H12F2O5S/c17-16(18,24(20,21)22)15(19)23-9-10-7-12-5-1-3-11-4-2-6-13(8-10)14(11)12/h1-3,5-8H,4,9H2,(H,20,21,22) |
| InChIKey | CYTQRJJVALUJKR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|