About acetylene;benzene;1H-phenalene
acetylene;benzene;1H-phenalene (PubChem CID 174693937) has the molecular formula C21H18
and a molecular weight of 270.38 g/mol. Its IUPAC name is acetylene;benzene;1H-phenalene.
Molecular Properties
| Compound Name | acetylene;benzene;1H-phenalene |
| PubChem CID | 174693937 |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | acetylene;benzene;1H-phenalene |
| SMILES | C#C.C1=Cc2cccc3cccc(c23)C1.c1ccccc1 |
| InChI | InChI=1S/C13H10.C6H6.C2H2/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;1-2-4-6-5-3-1;1-2/h1-8H,9H2;1-6H;1-2H |
| InChIKey | AJFKUQJJXWHGBT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;benzene;1H-phenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;benzene;1H-phenalene?
The IUPAC name of acetylene;benzene;1H-phenalene (CID 174693937) is acetylene;benzene;1H-phenalene.
What is the SMILES notation for acetylene;benzene;1H-phenalene?
The canonical SMILES for acetylene;benzene;1H-phenalene is C#C.C1=Cc2cccc3cccc(c23)C1.c1ccccc1.
What is the InChIKey of acetylene;benzene;1H-phenalene?
The InChIKey is AJFKUQJJXWHGBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C6H6.C2H2/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;1-2-4-6-5-3-1;1-2/h1-8H,9H2;1-6H;1-2H.
What are the key properties of acetylene;benzene;1H-phenalene?
acetylene;benzene;1H-phenalene has a molecular weight of 270.38 g/mol, XLogP of 5.35, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;benzene;1H-phenalene is sourced from PubChem (CID 174693937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).