About benzene;1H-phenalene;sulfane
benzene;1H-phenalene;sulfane (PubChem CID 174365170) has the molecular formula C19H18S
and a molecular weight of 278.42 g/mol. Its IUPAC name is benzene;1H-phenalene;sulfane.
Molecular Properties
| Compound Name | benzene;1H-phenalene;sulfane |
| PubChem CID | 174365170 |
| Molecular Formula | C19H18S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | benzene;1H-phenalene;sulfane |
| SMILES | C1=Cc2cccc3cccc(c23)C1.S.c1ccccc1 |
| InChI | InChI=1S/C13H10.C6H6.H2S/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;1-2-4-6-5-3-1;/h1-8H,9H2;1-6H;1H2 |
| InChIKey | YSQQTNFSEQNPPV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzene;1H-phenalene;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1H-phenalene;sulfane?
The IUPAC name of benzene;1H-phenalene;sulfane (CID 174365170) is benzene;1H-phenalene;sulfane.
What is the SMILES notation for benzene;1H-phenalene;sulfane?
The canonical SMILES for benzene;1H-phenalene;sulfane is C1=Cc2cccc3cccc(c23)C1.S.c1ccccc1.
What is the InChIKey of benzene;1H-phenalene;sulfane?
The InChIKey is YSQQTNFSEQNPPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C6H6.H2S/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;1-2-4-6-5-3-1;/h1-8H,9H2;1-6H;1H2.
What are the key properties of benzene;1H-phenalene;sulfane?
benzene;1H-phenalene;sulfane has a molecular weight of 278.42 g/mol, XLogP of 5.21, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1H-phenalene;sulfane is sourced from PubChem (CID 174365170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).