About 1H-phenalene;prop-2-ynoic acid
1H-phenalene;prop-2-ynoic acid (PubChem CID 174671367) has the molecular formula C16H12O2
and a molecular weight of 236.27 g/mol. Its IUPAC name is 1H-phenalene;prop-2-ynoic acid.
Molecular Properties
| Compound Name | 1H-phenalene;prop-2-ynoic acid |
| PubChem CID | 174671367 |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1H-phenalene;prop-2-ynoic acid |
| SMILES | C#CC(=O)O.C1=Cc2cccc3cccc(c23)C1 |
| InChI | InChI=1S/C13H10.C3H2O2/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;1-2-3(4)5/h1-8H,9H2;1H,(H,4,5) |
| InChIKey | QUJIKNBUNREYGN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1H-phenalene;prop-2-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-phenalene;prop-2-ynoic acid?
The IUPAC name of 1H-phenalene;prop-2-ynoic acid (CID 174671367) is 1H-phenalene;prop-2-ynoic acid.
What is the SMILES notation for 1H-phenalene;prop-2-ynoic acid?
The canonical SMILES for 1H-phenalene;prop-2-ynoic acid is C#CC(=O)O.C1=Cc2cccc3cccc(c23)C1.
What is the InChIKey of 1H-phenalene;prop-2-ynoic acid?
The InChIKey is QUJIKNBUNREYGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C3H2O2/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;1-2-3(4)5/h1-8H,9H2;1H,(H,4,5).
What are the key properties of 1H-phenalene;prop-2-ynoic acid?
1H-phenalene;prop-2-ynoic acid has a molecular weight of 236.27 g/mol, XLogP of 3.11, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-phenalene;prop-2-ynoic acid is sourced from PubChem (CID 174671367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).