About 1H-phenalene;hydrofluoride
1H-phenalene;hydrofluoride (PubChem CID 174317076) has the molecular formula C13H11F
and a molecular weight of 186.23 g/mol. Its IUPAC name is 1H-phenalene;hydrofluoride.
Molecular Properties
| Compound Name | 1H-phenalene;hydrofluoride |
| PubChem CID | 174317076 |
| Molecular Formula | C13H11F |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 1H-phenalene;hydrofluoride |
| SMILES | C1=Cc2cccc3cccc(c23)C1.F |
| InChI | InChI=1S/C13H10.FH/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;/h1-8H,9H2;1H |
| InChIKey | NNLABCWUKYOBGL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1H-phenalene;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-phenalene;hydrofluoride?
The IUPAC name of 1H-phenalene;hydrofluoride (CID 174317076) is 1H-phenalene;hydrofluoride.
What is the SMILES notation for 1H-phenalene;hydrofluoride?
The canonical SMILES for 1H-phenalene;hydrofluoride is C1=Cc2cccc3cccc(c23)C1.F.
What is the InChIKey of 1H-phenalene;hydrofluoride?
The InChIKey is NNLABCWUKYOBGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.FH/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;/h1-8H,9H2;1H.
What are the key properties of 1H-phenalene;hydrofluoride?
1H-phenalene;hydrofluoride has a molecular weight of 186.23 g/mol, XLogP of 3.56, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-phenalene;hydrofluoride is sourced from PubChem (CID 174317076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).