C19H20N2O2 — CID 66750988
bis(4,5-dihydro-1,3-oxazole);1H-phenalene (PubChem CID 66750988) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is bis(4,5-dihydro-1,3-oxazole);1H-phenalene.
| Compound Name | bis(4,5-dihydro-1,3-oxazole);1H-phenalene |
|---|---|
| PubChem CID | 66750988 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | bis(4,5-dihydro-1,3-oxazole);1H-phenalene |
| SMILES | C1=Cc2cccc3cccc(c23)C1.C1=NCCO1.C1=NCCO1 |
| InChI | InChI=1S/C13H10.2C3H5NO/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;2*1-2-5-3-4-1/h1-8H,9H2;2*3H,1-2H2 |
| InChIKey | RASNJTZFEOTCDE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |