About 4-methyl-1H-phenalene;1H-phenalene
4-methyl-1H-phenalene;1H-phenalene (PubChem CID 173399695) has the molecular formula C27H22
and a molecular weight of 346.47 g/mol. Its IUPAC name is 4-methyl-1H-phenalene;1H-phenalene.
Molecular Properties
| Compound Name | 4-methyl-1H-phenalene;1H-phenalene |
| PubChem CID | 173399695 |
| Molecular Formula | C27H22 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 4-methyl-1H-phenalene;1H-phenalene |
| SMILES | C1=Cc2cccc3cccc(c23)C1.Cc1ccc2cccc3c2c1C=CC3 |
| InChI | InChI=1S/C14H12.C13H10/c1-10-8-9-12-5-2-4-11-6-3-7-13(10)14(11)12;1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12/h2-5,7-9H,6H2,1H3;1-8H,9H2 |
| InChIKey | WSJSYXZSXHCILP-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-methyl-1H-phenalene;1H-phenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1H-phenalene;1H-phenalene?
The IUPAC name of 4-methyl-1H-phenalene;1H-phenalene (CID 173399695) is 4-methyl-1H-phenalene;1H-phenalene.
What is the SMILES notation for 4-methyl-1H-phenalene;1H-phenalene?
The canonical SMILES for 4-methyl-1H-phenalene;1H-phenalene is C1=Cc2cccc3cccc(c23)C1.Cc1ccc2cccc3c2c1C=CC3.
What is the InChIKey of 4-methyl-1H-phenalene;1H-phenalene?
The InChIKey is WSJSYXZSXHCILP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.C13H10/c1-10-8-9-12-5-2-4-11-6-3-7-13(10)14(11)12;1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12/h2-5,7-9H,6H2,1H3;1-8H,9H2.
What are the key properties of 4-methyl-1H-phenalene;1H-phenalene?
4-methyl-1H-phenalene;1H-phenalene has a molecular weight of 346.47 g/mol, XLogP of 7.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1H-phenalene;1H-phenalene is sourced from PubChem (CID 173399695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).