About 4-iodo-1H-phenalene
4-iodo-1H-phenalene (PubChem CID 156512606) has the molecular formula C13H9I
and a molecular weight of 292.12 g/mol. Its IUPAC name is 4-iodo-1H-phenalene.
Molecular Properties
| Compound Name | 4-iodo-1H-phenalene |
| PubChem CID | 156512606 |
| Molecular Formula | C13H9I |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | 4-iodo-1H-phenalene |
| SMILES | Ic1ccc2cccc3c2c1C=CC3 |
| InChI | InChI=1S/C13H9I/c14-12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10/h1-4,6-8H,5H2 |
| InChIKey | FRXWDAIZJDCOBG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-1H-phenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-1H-phenalene?
The IUPAC name of 4-iodo-1H-phenalene (CID 156512606) is 4-iodo-1H-phenalene.
What is the SMILES notation for 4-iodo-1H-phenalene?
The canonical SMILES for 4-iodo-1H-phenalene is Ic1ccc2cccc3c2c1C=CC3.
What is the InChIKey of 4-iodo-1H-phenalene?
The InChIKey is FRXWDAIZJDCOBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9I/c14-12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10/h1-4,6-8H,5H2.
What are the key properties of 4-iodo-1H-phenalene?
4-iodo-1H-phenalene has a molecular weight of 292.12 g/mol, XLogP of 4.01, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-1H-phenalene is sourced from PubChem (CID 156512606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).