About 4-ethenyl-1H-phenalene;N-methylmethanamine
4-ethenyl-1H-phenalene;N-methylmethanamine (PubChem CID 174594490) has the molecular formula C17H19N
and a molecular weight of 237.35 g/mol. Its IUPAC name is 4-ethenyl-1H-phenalene;N-methylmethanamine.
Molecular Properties
| Compound Name | 4-ethenyl-1H-phenalene;N-methylmethanamine |
| PubChem CID | 174594490 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 4-ethenyl-1H-phenalene;N-methylmethanamine |
| SMILES | C=Cc1ccc2cccc3c2c1C=CC3.CNC |
| InChI | InChI=1S/C15H12.C2H7N/c1-2-11-9-10-13-6-3-5-12-7-4-8-14(11)15(12)13;1-3-2/h2-6,8-10H,1,7H2;3H,1-2H3 |
| InChIKey | RTEMKEOAOUPSST-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethenyl-1H-phenalene;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-1H-phenalene;N-methylmethanamine?
The IUPAC name of 4-ethenyl-1H-phenalene;N-methylmethanamine (CID 174594490) is 4-ethenyl-1H-phenalene;N-methylmethanamine.
What is the SMILES notation for 4-ethenyl-1H-phenalene;N-methylmethanamine?
The canonical SMILES for 4-ethenyl-1H-phenalene;N-methylmethanamine is C=Cc1ccc2cccc3c2c1C=CC3.CNC.
What is the InChIKey of 4-ethenyl-1H-phenalene;N-methylmethanamine?
The InChIKey is RTEMKEOAOUPSST-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12.C2H7N/c1-2-11-9-10-13-6-3-5-12-7-4-8-14(11)15(12)13;1-3-2/h2-6,8-10H,1,7H2;3H,1-2H3.
What are the key properties of 4-ethenyl-1H-phenalene;N-methylmethanamine?
4-ethenyl-1H-phenalene;N-methylmethanamine has a molecular weight of 237.35 g/mol, XLogP of 3.89, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-1H-phenalene;N-methylmethanamine is sourced from PubChem (CID 174594490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).