About cyclobutene;1H-phenalene
cyclobutene;1H-phenalene (PubChem CID 175310152) has the molecular formula C17H16
and a molecular weight of 220.31 g/mol. Its IUPAC name is cyclobutene;1H-phenalene.
Molecular Properties
| Compound Name | cyclobutene;1H-phenalene |
| PubChem CID | 175310152 |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | cyclobutene;1H-phenalene |
| SMILES | C1=CCC1.C1=Cc2cccc3cccc(c23)C1 |
| InChI | InChI=1S/C13H10.C4H6/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;1-2-4-3-1/h1-8H,9H2;1-2H,3-4H2 |
| InChIKey | KMQWSEFDOTVWLZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclobutene;1H-phenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutene;1H-phenalene?
The IUPAC name of cyclobutene;1H-phenalene (CID 175310152) is cyclobutene;1H-phenalene.
What is the SMILES notation for cyclobutene;1H-phenalene?
The canonical SMILES for cyclobutene;1H-phenalene is C1=CCC1.C1=Cc2cccc3cccc(c23)C1.
What is the InChIKey of cyclobutene;1H-phenalene?
The InChIKey is KMQWSEFDOTVWLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C4H6/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;1-2-4-3-1/h1-8H,9H2;1-2H,3-4H2.
What are the key properties of cyclobutene;1H-phenalene?
cyclobutene;1H-phenalene has a molecular weight of 220.31 g/mol, XLogP of 4.75, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutene;1H-phenalene is sourced from PubChem (CID 175310152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).