C12H12F2O6S — CID 165046553
2-[[4-(ethenoxymethyl)phenyl]methoxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 165046553) has the molecular formula C12H12F2O6S and a molecular weight of 322.29 g/mol. Its IUPAC name is 2-[[4-(ethenoxymethyl)phenyl]methoxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[[4-(ethenoxymethyl)phenyl]methoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 165046553 |
| Molecular Formula | C12H12F2O6S |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-[[4-(ethenoxymethyl)phenyl]methoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | C=COCc1ccc(COC(=O)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C12H12F2O6S/c1-2-19-7-9-3-5-10(6-4-9)8-20-11(15)12(13,14)21(16,17)18/h2-6H,1,7-8H2,(H,16,17,18) |
| InChIKey | OZPJZJLBWOTPSU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|