(4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate

C13H9F7O2 — CID 71672799

IUPAC(4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate
SMILESC=CC(C(=O)OCc1ccc(F)cc1)(C(F)(F)F)C(F)(F)F
InChIInChI=1S/C13H9F7O2/c1-2-11(12(15,16)17,13(18,19)20)10(21)22-7-8-3-5-9(14)6-4-8/h2-6H,1,7H2
InChIKeyRXWWKGHCUHTZLO-UHFFFAOYSA-N
MW330.20 g/mol
LogP4.17
Rot. Bonds4

About (4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate

(4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate (PubChem CID 71672799) has the molecular formula C13H9F7O2 and a molecular weight of 330.20 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate.

Molecular Properties

Compound Name(4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate
PubChem CID71672799
Molecular FormulaC13H9F7O2
Molecular Weight330.20 g/mol
Exact Mass330.05
IUPAC Name(4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate
SMILESC=CC(C(=O)OCc1ccc(F)cc1)(C(F)(F)F)C(F)(F)F
InChIInChI=1S/C13H9F7O2/c1-2-11(12(15,16)17,13(18,19)20)10(21)22-7-8-3-5-9(14)6-4-8/h2-6H,1,7H2
InChIKeyRXWWKGHCUHTZLO-UHFFFAOYSA-N
XLogP4.17
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.20
LogP ≤ 54.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate?
The IUPAC name of (4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate (CID 71672799) is (4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate.
What is the SMILES notation for (4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate?
The canonical SMILES for (4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate is C=CC(C(=O)OCc1ccc(F)cc1)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of (4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate?
The InChIKey is RXWWKGHCUHTZLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F7O2/c1-2-11(12(15,16)17,13(18,19)20)10(21)22-7-8-3-5-9(14)6-4-8/h2-6H,1,7H2.
What are the key properties of (4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate?
(4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate has a molecular weight of 330.20 g/mol, XLogP of 4.17, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate is sourced from PubChem (CID 71672799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).