C13H9F7O2 — CID 71672799
(4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate (PubChem CID 71672799) has the molecular formula C13H9F7O2 and a molecular weight of 330.20 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate.
| Compound Name | (4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate |
|---|---|
| PubChem CID | 71672799 |
| Molecular Formula | C13H9F7O2 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | (4-fluorophenyl)methyl 2,2-bis(trifluoromethyl)but-3-enoate |
| SMILES | C=CC(C(=O)OCc1ccc(F)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H9F7O2/c1-2-11(12(15,16)17,13(18,19)20)10(21)22-7-8-3-5-9(14)6-4-8/h2-6H,1,7H2 |
| InChIKey | RXWWKGHCUHTZLO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|