C12H14FNO2 — CID 90939043
2-[(4-fluorophenyl)methoxy]pent-4-enamide (PubChem CID 90939043) has the molecular formula C12H14FNO2 and a molecular weight of 223.25 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methoxy]pent-4-enamide.
| Compound Name | 2-[(4-fluorophenyl)methoxy]pent-4-enamide |
|---|---|
| PubChem CID | 90939043 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-[(4-fluorophenyl)methoxy]pent-4-enamide |
| SMILES | C=CCC(OCc1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C12H14FNO2/c1-2-3-11(12(14)15)16-8-9-4-6-10(13)7-5-9/h2,4-7,11H,1,3,8H2,(H2,14,15) |
| InChIKey | NFVNHJMIOKFXOT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|