C21H19F3O6S — CID 170051014
ethyl 2-[2-[[7-(trifluoromethylsulfonyloxy)-1H-inden-5-yl]methoxy]phenyl]acetate (PubChem CID 170051014) has the molecular formula C21H19F3O6S and a molecular weight of 456.44 g/mol. Its IUPAC name is ethyl 2-[2-[[7-(trifluoromethylsulfonyloxy)-1H-inden-5-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[7-(trifluoromethylsulfonyloxy)-1H-inden-5-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 170051014 |
| Molecular Formula | C21H19F3O6S |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | ethyl 2-[2-[[7-(trifluoromethylsulfonyloxy)-1H-inden-5-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1cc2c(c(OS(=O)(=O)C(F)(F)F)c1)CC=C2 |
| InChI | InChI=1S/C21H19F3O6S/c1-2-28-20(25)12-16-6-3-4-9-18(16)29-13-14-10-15-7-5-8-17(15)19(11-14)30-31(26,27)21(22,23)24/h3-7,9-11H,2,8,12-13H2,1H3 |
| InChIKey | SMNDGYMNJXWVRX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|