C27H25IO5 — CID 139560775
ethyl 2-[2-[[7-iodo-2-(phenylmethoxymethyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate (PubChem CID 139560775) has the molecular formula C27H25IO5 and a molecular weight of 556.40 g/mol. Its IUPAC name is ethyl 2-[2-[[7-iodo-2-(phenylmethoxymethyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[7-iodo-2-(phenylmethoxymethyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 139560775 |
| Molecular Formula | C27H25IO5 |
| Molecular Weight | 556.40 g/mol |
| Exact Mass | 556.07 |
| IUPAC Name | ethyl 2-[2-[[7-iodo-2-(phenylmethoxymethyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1cc(I)c2oc(COCc3ccccc3)cc2c1 |
| InChI | InChI=1S/C27H25IO5/c1-2-31-26(29)15-21-10-6-7-11-25(21)32-17-20-12-22-14-23(33-27(22)24(28)13-20)18-30-16-19-8-4-3-5-9-19/h3-14H,2,15-18H2,1H3 |
| InChIKey | ONQUTGXVFMVLFL-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.40 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|