C23H23IO5 — CID 139560150
ethyl 2-[2-[[2-[cyclopropyl(hydroxy)methyl]-7-iodo-1-benzofuran-5-yl]methoxy]phenyl]acetate (PubChem CID 139560150) has the molecular formula C23H23IO5 and a molecular weight of 506.34 g/mol. Its IUPAC name is ethyl 2-[2-[[2-[cyclopropyl(hydroxy)methyl]-7-iodo-1-benzofuran-5-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[2-[cyclopropyl(hydroxy)methyl]-7-iodo-1-benzofuran-5-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 139560150 |
| Molecular Formula | C23H23IO5 |
| Molecular Weight | 506.34 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | ethyl 2-[2-[[2-[cyclopropyl(hydroxy)methyl]-7-iodo-1-benzofuran-5-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1cc(I)c2oc(C(O)C3CC3)cc2c1 |
| InChI | InChI=1S/C23H23IO5/c1-2-27-21(25)12-16-5-3-4-6-19(16)28-13-14-9-17-11-20(22(26)15-7-8-15)29-23(17)18(24)10-14/h3-6,9-11,15,22,26H,2,7-8,12-13H2,1H3 |
| InChIKey | IALDHELNYMHRKG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.34 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|