C28H26O5 — CID 157188122
ethyl 2-[2-[[7-(3-ethylphenyl)-2-formyl-1-benzofuran-5-yl]methoxy]phenyl]acetate (PubChem CID 157188122) has the molecular formula C28H26O5 and a molecular weight of 442.51 g/mol. Its IUPAC name is ethyl 2-[2-[[7-(3-ethylphenyl)-2-formyl-1-benzofuran-5-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[7-(3-ethylphenyl)-2-formyl-1-benzofuran-5-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 157188122 |
| Molecular Formula | C28H26O5 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | ethyl 2-[2-[[7-(3-ethylphenyl)-2-formyl-1-benzofuran-5-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1cc(-c2cccc(CC)c2)c2oc(C=O)cc2c1 |
| InChI | InChI=1S/C28H26O5/c1-3-19-8-7-10-21(12-19)25-14-20(13-23-15-24(17-29)33-28(23)25)18-32-26-11-6-5-9-22(26)16-27(30)31-4-2/h5-15,17H,3-4,16,18H2,1-2H3 |
| InChIKey | GAWIGTWROGLPES-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|