C26H25IN2O5 — CID 139561063
ethyl 2-[2-[[7-iodo-2-[[(5-methoxy-3-pyridinyl)amino]methyl]-1-benzofuran-5-yl]methoxy]phenyl]acetate (PubChem CID 139561063) has the molecular formula C26H25IN2O5 and a molecular weight of 572.40 g/mol. Its IUPAC name is ethyl 2-[2-[[7-iodo-2-[[(5-methoxy-3-pyridinyl)amino]methyl]-1-benzofuran-5-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[7-iodo-2-[[(5-methoxy-3-pyridinyl)amino]methyl]-1-benzofuran-5-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 139561063 |
| Molecular Formula | C26H25IN2O5 |
| Molecular Weight | 572.40 g/mol |
| Exact Mass | 572.08 |
| IUPAC Name | ethyl 2-[2-[[7-iodo-2-[[(5-methoxy-3-pyridinyl)amino]methyl]-1-benzofuran-5-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1cc(I)c2oc(CNc3cncc(OC)c3)cc2c1 |
| InChI | InChI=1S/C26H25IN2O5/c1-3-32-25(30)11-18-6-4-5-7-24(18)33-16-17-8-19-10-22(34-26(19)23(27)9-17)15-29-20-12-21(31-2)14-28-13-20/h4-10,12-14,29H,3,11,15-16H2,1-2H3 |
| InChIKey | ILEMZPPLWXICMT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.40 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|