C21H20F2O7S — CID 88570365
1,1-difluoro-2-[[5-(naphthalen-1-ylmethoxycarbonyl)-2-bicyclo[2.2.1]heptanyl]oxy]-2-oxoethanesulfonic acid (PubChem CID 88570365) has the molecular formula C21H20F2O7S and a molecular weight of 454.45 g/mol. Its IUPAC name is 1,1-difluoro-2-[[5-(naphthalen-1-ylmethoxycarbonyl)-2-bicyclo[2.2.1]heptanyl]oxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[5-(naphthalen-1-ylmethoxycarbonyl)-2-bicyclo[2.2.1]heptanyl]oxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 88570365 |
| Molecular Formula | C21H20F2O7S |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 1,1-difluoro-2-[[5-(naphthalen-1-ylmethoxycarbonyl)-2-bicyclo[2.2.1]heptanyl]oxy]-2-oxoethanesulfonic acid |
| SMILES | O=C(OCc1cccc2ccccc12)C1CC2CC1CC2OC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C21H20F2O7S/c22-21(23,31(26,27)28)20(25)30-18-10-14-8-15(18)9-17(14)19(24)29-11-13-6-3-5-12-4-1-2-7-16(12)13/h1-7,14-15,17-18H,8-11H2,(H,26,27,28) |
| InChIKey | AZWXLQSPVOTNNJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|