C16H14F2O4S — CID 89361568
[4-[(4-ethenylphenyl)methoxy]phenyl]-difluoromethanesulfonic acid (PubChem CID 89361568) has the molecular formula C16H14F2O4S and a molecular weight of 340.35 g/mol. Its IUPAC name is [4-[(4-ethenylphenyl)methoxy]phenyl]-difluoromethanesulfonic acid.
| Compound Name | [4-[(4-ethenylphenyl)methoxy]phenyl]-difluoromethanesulfonic acid |
|---|---|
| PubChem CID | 89361568 |
| Molecular Formula | C16H14F2O4S |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | [4-[(4-ethenylphenyl)methoxy]phenyl]-difluoromethanesulfonic acid |
| SMILES | C=Cc1ccc(COc2ccc(C(F)(F)S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H14F2O4S/c1-2-12-3-5-13(6-4-12)11-22-15-9-7-14(8-10-15)16(17,18)23(19,20)21/h2-10H,1,11H2,(H,19,20,21) |
| InChIKey | DCFZDXBRHUFLQB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|