C9H9F2NO2S — CID 175410018
(4-ethenylphenyl)-difluoromethanesulfonamide (PubChem CID 175410018) has the molecular formula C9H9F2NO2S and a molecular weight of 233.24 g/mol. Its IUPAC name is (4-ethenylphenyl)-difluoromethanesulfonamide.
| Compound Name | (4-ethenylphenyl)-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 175410018 |
| Molecular Formula | C9H9F2NO2S |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | (4-ethenylphenyl)-difluoromethanesulfonamide |
| SMILES | C=Cc1ccc(C(F)(F)S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C9H9F2NO2S/c1-2-7-3-5-8(6-4-7)9(10,11)15(12,13)14/h2-6H,1H2,(H2,12,13,14) |
| InChIKey | KDZRRLSIMANFJZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |