C13H12F6O7S2 — CID 123197637
3-[2-(4-ethenylphenoxy)ethoxysulfonyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 123197637) has the molecular formula C13H12F6O7S2 and a molecular weight of 458.35 g/mol. Its IUPAC name is 3-[2-(4-ethenylphenoxy)ethoxysulfonyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[2-(4-ethenylphenoxy)ethoxysulfonyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 123197637 |
| Molecular Formula | C13H12F6O7S2 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | 3-[2-(4-ethenylphenoxy)ethoxysulfonyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | C=Cc1ccc(OCCOS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C13H12F6O7S2/c1-2-9-3-5-10(6-4-9)25-7-8-26-28(23,24)13(18,19)11(14,15)12(16,17)27(20,21)22/h2-6H,1,7-8H2,(H,20,21,22) |
| InChIKey | JFGPIBQDTPZARM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|