C12H12F2NO5S- — CID 154615117
2-[2-(4-ethenylphenoxy)ethylamino]-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 154615117) has the molecular formula C12H12F2NO5S- and a molecular weight of 320.29 g/mol. Its IUPAC name is 2-[2-(4-ethenylphenoxy)ethylamino]-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 2-[2-(4-ethenylphenoxy)ethylamino]-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 154615117 |
| Molecular Formula | C12H12F2NO5S- |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2-[2-(4-ethenylphenoxy)ethylamino]-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | C=Cc1ccc(OCCNC(=O)C(F)(F)S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C12H13F2NO5S/c1-2-9-3-5-10(6-4-9)20-8-7-15-11(16)12(13,14)21(17,18)19/h2-6H,1,7-8H2,(H,15,16)(H,17,18,19)/p-1 |
| InChIKey | ZBBYSXKNTUNUGL-UHFFFAOYSA-M |
| XLogP | 0.96 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|