C19H11F10O5S- — CID 140670053
4-[5-(4-ethenylphenoxy)-2,2,3,3,4,4-hexafluoropentoxy]-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 140670053) has the molecular formula C19H11F10O5S- and a molecular weight of 541.34 g/mol. Its IUPAC name is 4-[5-(4-ethenylphenoxy)-2,2,3,3,4,4-hexafluoropentoxy]-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-[5-(4-ethenylphenoxy)-2,2,3,3,4,4-hexafluoropentoxy]-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 140670053 |
| Molecular Formula | C19H11F10O5S- |
| Molecular Weight | 541.34 g/mol |
| Exact Mass | 541.02 |
| IUPAC Name | 4-[5-(4-ethenylphenoxy)-2,2,3,3,4,4-hexafluoropentoxy]-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | C=Cc1ccc(OCC(F)(F)C(F)(F)C(F)(F)COc2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)cc1 |
| InChI | InChI=1S/C19H12F10O5S/c1-2-9-3-5-10(6-4-9)33-7-17(24,25)19(28,29)18(26,27)8-34-15-11(20)13(22)16(35(30,31)32)14(23)12(15)21/h2-6H,1,7-8H2,(H,30,31,32)/p-1 |
| InChIKey | LLQJFIMSUIWFCU-UHFFFAOYSA-M |
| XLogP | 5.15 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.34 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|