C20H11F13NO6S2- — CID 140670025
[4-[5-(4-ethenylphenoxy)-2,2,3,3,4,4-hexafluoropentoxy]-2,3,5,6-tetrafluorophenyl]sulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 140670025) has the molecular formula C20H11F13NO6S2- and a molecular weight of 672.42 g/mol. Its IUPAC name is [4-[5-(4-ethenylphenoxy)-2,2,3,3,4,4-hexafluoropentoxy]-2,3,5,6-tetrafluorophenyl]sulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | [4-[5-(4-ethenylphenoxy)-2,2,3,3,4,4-hexafluoropentoxy]-2,3,5,6-tetrafluorophenyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 140670025 |
| Molecular Formula | C20H11F13NO6S2- |
| Molecular Weight | 672.42 g/mol |
| Exact Mass | 671.98 |
| IUPAC Name | [4-[5-(4-ethenylphenoxy)-2,2,3,3,4,4-hexafluoropentoxy]-2,3,5,6-tetrafluorophenyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | C=Cc1ccc(OCC(F)(F)C(F)(F)C(F)(F)COc2c(F)c(F)c(S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)c(F)c2F)cc1 |
| InChI | InChI=1S/C20H11F13NO6S2/c1-2-9-3-5-10(6-4-9)39-7-17(25,26)19(29,30)18(27,28)8-40-15-11(21)13(23)16(14(24)12(15)22)41(35,36)34-42(37,38)20(31,32)33/h2-6H,1,7-8H2/q-1 |
| InChIKey | GOZKWCDIRKAGIL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 100.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.42 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|