C14H13F9O5S2 — CID 173199756
4-(2-ethenoxyethoxy)benzenethiol;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid (PubChem CID 173199756) has the molecular formula C14H13F9O5S2 and a molecular weight of 496.37 g/mol. Its IUPAC name is 4-(2-ethenoxyethoxy)benzenethiol;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid.
| Compound Name | 4-(2-ethenoxyethoxy)benzenethiol;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 173199756 |
| Molecular Formula | C14H13F9O5S2 |
| Molecular Weight | 496.37 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | 4-(2-ethenoxyethoxy)benzenethiol;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
| SMILES | C=COCCOc1ccc(S)cc1.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H12O2S.C4HF9O3S/c1-2-11-7-8-12-9-3-5-10(13)6-4-9;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h2-6,13H,1,7-8H2;(H,14,15,16) |
| InChIKey | PTWVKAREOZNVDL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|