C16H18O2 — CID 68832000
2-ethenyl-6-(2-ethoxyethoxy)naphthalene (PubChem CID 68832000) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-ethenyl-6-(2-ethoxyethoxy)naphthalene.
| Compound Name | 2-ethenyl-6-(2-ethoxyethoxy)naphthalene |
|---|---|
| PubChem CID | 68832000 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-ethenyl-6-(2-ethoxyethoxy)naphthalene |
| SMILES | C=Cc1ccc2cc(OCCOCC)ccc2c1 |
| InChI | InChI=1S/C16H18O2/c1-3-13-5-6-15-12-16(8-7-14(15)11-13)18-10-9-17-4-2/h3,5-8,11-12H,1,4,9-10H2,2H3 |
| InChIKey | OKMMEEHYPUWDKW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|