C22H16ClF4N5O3 — CID 134115814
2-chloro-N-[(2E)-2-(3-fluorophenyl)-2-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]ethyl]pyridine-3-carboxamide (PubChem CID 134115814) has the molecular formula C22H16ClF4N5O3 and a molecular weight of 509.85 g/mol. Its IUPAC name is 2-chloro-N-[(2E)-2-(3-fluorophenyl)-2-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]ethyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[(2E)-2-(3-fluorophenyl)-2-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134115814 |
| Molecular Formula | C22H16ClF4N5O3 |
| Molecular Weight | 509.85 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 2-chloro-N-[(2E)-2-(3-fluorophenyl)-2-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(N/N=C(/CNC(=O)c1cccnc1Cl)c1cccc(F)c1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H16ClF4N5O3/c23-19-17(5-2-10-28-19)20(33)29-12-18(13-3-1-4-14(24)11-13)31-32-21(34)30-15-6-8-16(9-7-15)35-22(25,26)27/h1-11H,12H2,(H,29,33)(H2,30,32,34)/b31-18- |
| InChIKey | BMKAUVBXMUEILZ-MNBJERMJSA-N |
| XLogP | 4.73 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.85 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|