C20H14F3N3O5 — CID 91438961
3-[[3-[[4-(trifluoromethoxy)phenyl]carbamoylamino]-2-pyridinyl]oxy]benzoic acid (PubChem CID 91438961) has the molecular formula C20H14F3N3O5 and a molecular weight of 433.34 g/mol. Its IUPAC name is 3-[[3-[[4-(trifluoromethoxy)phenyl]carbamoylamino]-2-pyridinyl]oxy]benzoic acid.
| Compound Name | 3-[[3-[[4-(trifluoromethoxy)phenyl]carbamoylamino]-2-pyridinyl]oxy]benzoic acid |
|---|---|
| PubChem CID | 91438961 |
| Molecular Formula | C20H14F3N3O5 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 3-[[3-[[4-(trifluoromethoxy)phenyl]carbamoylamino]-2-pyridinyl]oxy]benzoic acid |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)Nc1cccnc1Oc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C20H14F3N3O5/c21-20(22,23)31-14-8-6-13(7-9-14)25-19(29)26-16-5-2-10-24-17(16)30-15-4-1-3-12(11-15)18(27)28/h1-11H,(H,27,28)(H2,25,26,29) |
| InChIKey | TZLVDRXVZKRXAR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |